BetterGrades Precalculus · Unit 11 · Lesson

Sum and difference formulas

Derive and apply sine, cosine, and tangent sum and difference formulas.

Textbook reading

The problem that opens the lesson

Find cos 1515 degrees exactly without a calculator.

Solution

Begin by identifying the mathematical object and the information that fixes it. Choose angles with known exact values, apply the correct formula with parentheses, simplify radicals, and use quadrant reasoning to check the sign. The relevant conditions are not optional bookkeeping: Tangent sum formulas require denominators to be nonzero and should be used only where all expressions are defined. Following that structure gives cos(4530)=sqrt(6)+sqrt(2)4cos(45-30)=\frac{sqrt(6)+sqrt(2)}{4}.

Why this works

The formulas preserve both magnitude and sign interactions; they are not obtained by distributing sine or cosine across addition. The calculation and the representation should agree, so a graph, diagram, table, or substitution check should support the same conclusion.

Textbook reading

What this lesson is really about

Sum and difference formulas express trig values of combined angles in terms of the separate angles.

The cosine difference formula can be derived from distances or dot products between unit-circle points. The other formulas follow by substitutions, cofunction relationships, and quotient definitions.

The point is not merely to reproduce a formula. A learner should be able to identify the quantities or geometric objects involved, explain why the relationship has its stated form, and recognize when the same idea appears in a graph, table, diagram, or model.

Textbook reading

Why the relationship works

The formulas preserve both magnitude and sign interactions; they are not obtained by distributing sine or cosine across addition.

Textbook reading

A reliable way to work

Choose angles with known exact values, apply the correct formula with parentheses, simplify radicals, and use quadrant reasoning to check the sign.

Tangent sum formulas require denominators to be nonzero and should be used only where all expressions are defined.

After the symbolic work is complete, check the result. Depending on the lesson, this may mean substituting into an original equation, comparing coordinates, examining a graph, checking units, testing an interval, or confirming that every branch of a periodic solution has been included.

Textbook reading

What commonly goes wrong

A common error is writing sin(a+b)=sina+sinbsin(a+b)=sin a+sin b or losing the negative sign in cosine’s formula.

The repair is to return to the definition and identify the first step where the invalid solution stops describing the original mathematical object. Later algebra cannot rescue a first step that changed the domain, orientation, branch, or meaning of the problem.

Textbook reading

Worked examples

Worked example 1

Find cos 1515 degrees exactly without a calculator.

Solution

Begin by identifying the mathematical object and the information that fixes it. Choose angles with known exact values, apply the correct formula with parentheses, simplify radicals, and use quadrant reasoning to check the sign. The relevant conditions are not optional bookkeeping: Tangent sum formulas require denominators to be nonzero and should be used only where all expressions are defined. Following that structure gives cos(4530)=sqrt(6)+sqrt(2)4cos(45-30)=\frac{sqrt(6)+sqrt(2)}{4}.

Why this works

The formulas preserve both magnitude and sign interactions; they are not obtained by distributing sine or cosine across addition. The calculation and the representation should agree, so a graph, diagram, table, or substitution check should support the same conclusion.

Transfer example

Problem

Derive cos(alpha-beta) from a rotation or distance argument.

Worked development

Choose angles with known exact values, apply the correct formula with parentheses, simplify radicals, and use quadrant reasoning to check the sign. In this example, the first useful move is to make the defining structure visible rather than to search for a memorized answer. The cosine difference formula can be derived from distances or dot products between unit-circle points. The other formulas follow by substitutions, cofunction relationships, and quotient definitions. Then apply the conditions explicitly: Tangent sum formulas require denominators to be nonzero and should be used only where all expressions are defined. Finish by checking the result in a second representation and explaining what the result means.

Interpretation

Angle addition supports exact values, rotations, signal combination, and derivation of double-angle formulas.

Reasoning example

Problem

Find sin 7575 degrees exactly.

Worked development

Choose angles with known exact values, apply the correct formula with parentheses, simplify radicals, and use quadrant reasoning to check the sign. In this example, the first useful move is to make the defining structure visible rather than to search for a memorized answer. The cosine difference formula can be derived from distances or dot products between unit-circle points. The other formulas follow by substitutions, cofunction relationships, and quotient definitions. Then apply the conditions explicitly: Tangent sum formulas require denominators to be nonzero and should be used only where all expressions are defined. Finish by checking the result in a second representation and explaining what the result means.

Interpretation

Angle addition supports exact values, rotations, signal combination, and derivation of double-angle formulas.

Worked example 4: quick check

Find sin 1515 degrees exactly.

Solution

Begin by identifying the mathematical object and the information that fixes it. Choose angles with known exact values, apply the correct formula with parentheses, simplify radicals, and use quadrant reasoning to check the sign. The relevant conditions are not optional bookkeeping: Tangent sum formulas require denominators to be nonzero and should be used only where all expressions are defined. Following that structure gives sqrt(6)sqrt(2)4\frac{sqrt(6)-sqrt(2)}{4}.

Why this works

The formulas preserve both magnitude and sign interactions; they are not obtained by distributing sine or cosine across addition. The calculation and the representation should agree, so a graph, diagram, table, or substitution check should support the same conclusion.

Geometric derivation using rotated vectors. Follow the foundation example from its given information to the conclusion. The labels identify the mathematical feature that makes the result valid: The formulas preserve both magnitude and sign interactions; they are not obtained by distributing sine or cosine across addition. The calculation and the representation should agree, so a graph, diagram, table, or substitution check should support the same conclusion.
Read this graph as text

Sum and difference formulas · Geometric derivation using rotated vectors. Follow the foundation example from its given information to the conclusion. The labels identify the mathematical feature that makes the result valid: The formulas preserve both magnitude and sign interactions; they are not obtained by distributing sine or cosine across addition. The calculation and the representation should agree, so a graph, diagram, table, or substitution check should support the same conclusion. The figure uses concrete points, curves, arrows, intervals, or matrix structure instead of relying on color alone.

Labels, point shapes, line styles, arrows, and position carry the mathematical meaning; color is supplementary.

Why it matters: Use the mathematical objects in this figure to support the lesson outcome: Derive and apply sine, cosine, and tangent sum and difference formulas.

Anchor figure · Geometric derivation using rotated vectors

Follow the foundation example from its given information to the conclusion. The labels identify the mathematical feature that makes the result valid: The formulas preserve both magnitude and sign interactions; they are not obtained by distributing sine or cosine across addition. The calculation and the representation should agree, so a graph, diagram, table, or substitution check should support the same conclusion.

Exact-angle decomposition map. Read the numbered reasoning path in order. Each stage preserves the quantities, restrictions, or structural conditions needed for sum and difference formulas.
Read this graph as text

Sum and difference formulas · Exact-angle decomposition map. Read the numbered reasoning path in order. Each stage preserves the quantities, restrictions, or structural conditions needed for sum and difference formulas. The figure uses concrete points, curves, arrows, intervals, or matrix structure instead of relying on color alone.

Labels, point shapes, line styles, arrows, and position carry the mathematical meaning; color is supplementary.

Why it matters: Use the mathematical objects in this figure to support the lesson outcome: Derive and apply sine, cosine, and tangent sum and difference formulas.

Mechanism figure · Exact-angle decomposition map

Read the numbered reasoning path in order. Each stage preserves the quantities, restrictions, or structural conditions needed for sum and difference formulas.

Signal phase-combination diagram. Compare the valid path with the tempting shortcut. The figure shows why writing sin(a+b)=sin a+sin b or losing the negative sign in cosine’s formula leads to a false conclusion.
Read this graph as text

Sum and difference formulas · Signal phase-combination diagram. Compare the valid path with the tempting shortcut. The figure shows why writing sin(a+b)=sin a+sin b or losing the negative sign in cosine’s formula leads to a false conclusion. The figure uses concrete points, curves, arrows, intervals, or matrix structure instead of relying on color alone.

Labels, point shapes, line styles, arrows, and position carry the mathematical meaning; color is supplementary.

Why it matters: Use the mathematical objects in this figure to support the lesson outcome: Derive and apply sine, cosine, and tangent sum and difference formulas.

Comparison and error figure · Signal phase-combination diagram

Compare the valid path with the tempting shortcut. The figure shows why writing sin(a+b)=sina+sinbsin(a+b)=sin a+sin b or losing the negative sign in cosine’s formula leads to a false conclusion.

Textbook reading

Application and interpretation

Angle addition supports exact values, rotations, signal combination, and derivation of double-angle formulas.

A contextual answer must include units, a meaningful domain, and the assumptions that make the model plausible. An exact mathematical relationship should not be diluted into a decimal unless a measurement or comparison requires it.

Check yourself

Find sin 1515 degrees exactly.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice

Ten concrete questions

Practice 101

Find sin 1515 degrees exactly.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 202

Derive cos(alpha-beta) from a rotation or distance argument.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 303

Find sin 7575 degrees exactly.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 404

Use a sum formula to combine A sin x+Bx+B cos xx.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 505

State the defining idea behind sum and difference formulas in one precise sentence.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 606

What condition or domain restriction must remain visible in the solution?

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 707

Describe the most likely incorrect first step and explain why it fails.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 808

Translate the main result into a second representation: graph, diagram, table, equation, or context.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 909

Write one exact conclusion and one corresponding numerical approximation or verbal interpretation.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Practice 1010

Explain how this lesson's idea will be used later in the course.

Write a complete attempt before opening the exact answer.

Attempt once to unlock the answer

Complete a substantive attempt before revealing the server-held answer.

Textbook reading

Lesson summary

Sum and difference formulas express trig values of combined angles in terms of the separate angles.

The central condition to remember is this: Tangent sum formulas require denominators to be nonzero and should be used only where all expressions are defined.

Connection forward

The next lesson specializes the formulas to equal angles.

The next lesson is Double-angle formulas.

Source record

Original BetterGrades manuscript, rights-separated references.

  • Sundstrom & Schlicker, Trigonometry, Chapter 4
  • Lippman & Rasmussen, Precalculus Vol. 2, Chapter 7
  • Yoshiwara, Trigonometry, Chapters 5, 7, and 8
  • Corral, Trigonometry, Chapters 3 and 6

No long source passage is reproduced.